C21H21N4O4+ — CID 53291776
3-[methyl-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)methyl]amino]-1-(4-methylphenyl)pyrrolidine-2,5-dione (PubChem CID 53291776) has the molecular formula C21H21N4O4+ and a molecular weight of 393.42 g/mol. Its IUPAC name is 3-[methyl-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)methyl]amino]-1-(4-methylphenyl)pyrrolidine-2,5-dione.
| Compound Name | 3-[methyl-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)methyl]amino]-1-(4-methylphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 53291776 |
| Molecular Formula | C21H21N4O4+ |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 3-[methyl-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)methyl]amino]-1-(4-methylphenyl)pyrrolidine-2,5-dione |
| SMILES | Cc1ccc(N2C(=O)CC(N(C)Cc3c(=O)o[nH][n+]3-c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C21H20N4O4/c1-14-8-10-15(11-9-14)24-19(26)12-17(20(24)27)23(2)13-18-21(28)29-22-25(18)16-6-4-3-5-7-16/h3-11,17H,12-13H2,1-2H3/p+1 |
| InChIKey | OLHHFLSXUAJFDD-UHFFFAOYSA-O |
| XLogP | 1.32 |
| TPSA | 90.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|