C16H18N5O5+ — CID 53295799
N-[4-[3-[(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)methylamino]-2,5-dioxopyrrolidin-1-yl]phenyl]acetamide (PubChem CID 53295799) has the molecular formula C16H18N5O5+ and a molecular weight of 360.35 g/mol. Its IUPAC name is N-[4-[3-[(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)methylamino]-2,5-dioxopyrrolidin-1-yl]phenyl]acetamide.
| Compound Name | N-[4-[3-[(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)methylamino]-2,5-dioxopyrrolidin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 53295799 |
| Molecular Formula | C16H18N5O5+ |
| Molecular Weight | 360.35 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | N-[4-[3-[(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)methylamino]-2,5-dioxopyrrolidin-1-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(N2C(=O)CC(NCc3c(=O)o[nH][n+]3C)C2=O)cc1 |
| InChI | InChI=1S/C16H17N5O5/c1-9(22)18-10-3-5-11(6-4-10)21-14(23)7-12(15(21)24)17-8-13-16(25)26-19-20(13)2/h3-6,12,17H,7-8H2,1-2H3,(H-,18,19,22,25)/p+1 |
| InChIKey | DBKLBVLUFUDXBZ-UHFFFAOYSA-O |
| XLogP | -0.83 |
| TPSA | 128.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.35 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|