C23H24ClF3N4O3 — CID 24512306
3-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-1-(4-propoxyphenyl)pyrrolidine-2,5-dione (PubChem CID 24512306) has the molecular formula C23H24ClF3N4O3 and a molecular weight of 496.92 g/mol. Its IUPAC name is 3-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-1-(4-propoxyphenyl)pyrrolidine-2,5-dione.
| Compound Name | 3-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-1-(4-propoxyphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 24512306 |
| Molecular Formula | C23H24ClF3N4O3 |
| Molecular Weight | 496.92 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | 3-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-1-(4-propoxyphenyl)pyrrolidine-2,5-dione |
| SMILES | CCCOc1ccc(N2C(=O)CC(N3CCN(c4ncc(C(F)(F)F)cc4Cl)CC3)C2=O)cc1 |
| InChI | InChI=1S/C23H24ClF3N4O3/c1-2-11-34-17-5-3-16(4-6-17)31-20(32)13-19(22(31)33)29-7-9-30(10-8-29)21-18(24)12-15(14-28-21)23(25,26)27/h3-6,12,14,19H,2,7-11,13H2,1H3 |
| InChIKey | ALCFIPRXLFYVJT-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 65.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.92 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|