C17H18ClF2N3O4 — CID 3901669
1-[1-[4-[chloro(difluoro)methoxy]phenyl]-2,5-dioxopyrrolidin-3-yl]piperidine-4-carboxamide (PubChem CID 3901669) has the molecular formula C17H18ClF2N3O4 and a molecular weight of 401.80 g/mol. Its IUPAC name is 1-[1-[4-[chloro(difluoro)methoxy]phenyl]-2,5-dioxopyrrolidin-3-yl]piperidine-4-carboxamide.
| Compound Name | 1-[1-[4-[chloro(difluoro)methoxy]phenyl]-2,5-dioxopyrrolidin-3-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 3901669 |
| Molecular Formula | C17H18ClF2N3O4 |
| Molecular Weight | 401.80 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | 1-[1-[4-[chloro(difluoro)methoxy]phenyl]-2,5-dioxopyrrolidin-3-yl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C2CC(=O)N(c3ccc(OC(F)(F)Cl)cc3)C2=O)CC1 |
| InChI | InChI=1S/C17H18ClF2N3O4/c18-17(19,20)27-12-3-1-11(2-4-12)23-14(24)9-13(16(23)26)22-7-5-10(6-8-22)15(21)25/h1-4,10,13H,5-9H2,(H2,21,25) |
| InChIKey | ACQPXTLTXSMPNC-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.80 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|