C17H18N2O6 — CID 871176
1-[(3R)-1-(4-carboxyphenyl)-2,5-dioxopyrrolidin-3-yl]piperidine-4-carboxylic acid (PubChem CID 871176) has the molecular formula C17H18N2O6 and a molecular weight of 346.34 g/mol. Its IUPAC name is 1-[(3R)-1-(4-carboxyphenyl)-2,5-dioxopyrrolidin-3-yl]piperidine-4-carboxylic acid.
| Compound Name | 1-[(3R)-1-(4-carboxyphenyl)-2,5-dioxopyrrolidin-3-yl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 871176 |
| Molecular Formula | C17H18N2O6 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 1-[(3R)-1-(4-carboxyphenyl)-2,5-dioxopyrrolidin-3-yl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)c1ccc(N2C(=O)C[C@@H](N3CCC(C(=O)O)CC3)C2=O)cc1 |
| InChI | InChI=1S/C17H18N2O6/c20-14-9-13(18-7-5-11(6-8-18)17(24)25)15(21)19(14)12-3-1-10(2-4-12)16(22)23/h1-4,11,13H,5-9H2,(H,22,23)(H,24,25)/t13-/m1/s1 |
| InChIKey | RPPJIAPUULMTPO-CYBMUJFWSA-N |
| XLogP | 0.81 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|