C19H24N2O7 — CID 40961274
1-[(3R)-2,5-dioxo-1-(3,4,5-trimethoxyphenyl)pyrrolidin-3-yl]piperidine-4-carboxylic acid (PubChem CID 40961274) has the molecular formula C19H24N2O7 and a molecular weight of 392.41 g/mol. Its IUPAC name is 1-[(3R)-2,5-dioxo-1-(3,4,5-trimethoxyphenyl)pyrrolidin-3-yl]piperidine-4-carboxylic acid.
| Compound Name | 1-[(3R)-2,5-dioxo-1-(3,4,5-trimethoxyphenyl)pyrrolidin-3-yl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 40961274 |
| Molecular Formula | C19H24N2O7 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 1-[(3R)-2,5-dioxo-1-(3,4,5-trimethoxyphenyl)pyrrolidin-3-yl]piperidine-4-carboxylic acid |
| SMILES | COc1cc(N2C(=O)C[C@@H](N3CCC(C(=O)O)CC3)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C19H24N2O7/c1-26-14-8-12(9-15(27-2)17(14)28-3)21-16(22)10-13(18(21)23)20-6-4-11(5-7-20)19(24)25/h8-9,11,13H,4-7,10H2,1-3H3,(H,24,25)/t13-/m1/s1 |
| InChIKey | WVYCKMWYGCLIIB-CYBMUJFWSA-N |
| XLogP | 1.14 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|