C18H23ClN2O4 — CID 163326031
1-[1-(4-ethylphenyl)-2,5-dioxopyrrolidin-3-yl]piperidine-4-carboxylic acid;hydrochloride (PubChem CID 163326031) has the molecular formula C18H23ClN2O4 and a molecular weight of 366.85 g/mol. Its IUPAC name is 1-[1-(4-ethylphenyl)-2,5-dioxopyrrolidin-3-yl]piperidine-4-carboxylic acid;hydrochloride.
| Compound Name | 1-[1-(4-ethylphenyl)-2,5-dioxopyrrolidin-3-yl]piperidine-4-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 163326031 |
| Molecular Formula | C18H23ClN2O4 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 1-[1-(4-ethylphenyl)-2,5-dioxopyrrolidin-3-yl]piperidine-4-carboxylic acid;hydrochloride |
| SMILES | CCc1ccc(N2C(=O)CC(N3CCC(C(=O)O)CC3)C2=O)cc1.Cl |
| InChI | InChI=1S/C18H22N2O4.ClH/c1-2-12-3-5-14(6-4-12)20-16(21)11-15(17(20)22)19-9-7-13(8-10-19)18(23)24;/h3-6,13,15H,2,7-11H2,1H3,(H,23,24);1H |
| InChIKey | FCPNJYMBQWVULS-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|