C27H25ClIN3O2 — CID 1388367
(3R)-3-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]-1-(4-iodophenyl)pyrrolidine-2,5-dione (PubChem CID 1388367) has the molecular formula C27H25ClIN3O2 and a molecular weight of 585.87 g/mol. Its IUPAC name is (3R)-3-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]-1-(4-iodophenyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]-1-(4-iodophenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 1388367 |
| Molecular Formula | C27H25ClIN3O2 |
| Molecular Weight | 585.87 g/mol |
| Exact Mass | 585.07 |
| IUPAC Name | (3R)-3-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]-1-(4-iodophenyl)pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@@H](N2CCN([C@H](c3ccccc3)c3ccc(Cl)cc3)CC2)C(=O)N1c1ccc(I)cc1 |
| InChI | InChI=1S/C27H25ClIN3O2/c28-21-8-6-20(7-9-21)26(19-4-2-1-3-5-19)31-16-14-30(15-17-31)24-18-25(33)32(27(24)34)23-12-10-22(29)11-13-23/h1-13,24,26H,14-18H2/t24-,26-/m1/s1 |
| InChIKey | IFBGLGWKKHMAKD-AOYPEHQESA-N |
| XLogP | 4.98 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.87 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|