C33H31N3O2S — CID 98058728
(3R)-3-(4-benzhydrylpiperazin-1-yl)-1-(2-phenylsulfanylphenyl)pyrrolidine-2,5-dione (PubChem CID 98058728) has the molecular formula C33H31N3O2S and a molecular weight of 533.70 g/mol. Its IUPAC name is (3R)-3-(4-benzhydrylpiperazin-1-yl)-1-(2-phenylsulfanylphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-(4-benzhydrylpiperazin-1-yl)-1-(2-phenylsulfanylphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 98058728 |
| Molecular Formula | C33H31N3O2S |
| Molecular Weight | 533.70 g/mol |
| Exact Mass | 533.21 |
| IUPAC Name | (3R)-3-(4-benzhydrylpiperazin-1-yl)-1-(2-phenylsulfanylphenyl)pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@@H](N2CCN(C(c3ccccc3)c3ccccc3)CC2)C(=O)N1c1ccccc1Sc1ccccc1 |
| InChI | InChI=1S/C33H31N3O2S/c37-31-24-29(33(38)36(31)28-18-10-11-19-30(28)39-27-16-8-3-9-17-27)34-20-22-35(23-21-34)32(25-12-4-1-5-13-25)26-14-6-2-7-15-26/h1-19,29,32H,20-24H2/t29-/m1/s1 |
| InChIKey | WRJVFYCWAFKQGZ-GDLZYMKVSA-N |
| XLogP | 5.88 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.70 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|