C31H34N4O5S — CID 98124634
(3R)-3-(4-benzhydrylpiperazin-1-yl)-1-(4-morpholin-4-ylsulfonylphenyl)pyrrolidine-2,5-dione (PubChem CID 98124634) has the molecular formula C31H34N4O5S and a molecular weight of 574.70 g/mol. Its IUPAC name is (3R)-3-(4-benzhydrylpiperazin-1-yl)-1-(4-morpholin-4-ylsulfonylphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-(4-benzhydrylpiperazin-1-yl)-1-(4-morpholin-4-ylsulfonylphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 98124634 |
| Molecular Formula | C31H34N4O5S |
| Molecular Weight | 574.70 g/mol |
| Exact Mass | 574.22 |
| IUPAC Name | (3R)-3-(4-benzhydrylpiperazin-1-yl)-1-(4-morpholin-4-ylsulfonylphenyl)pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@@H](N2CCN(C(c3ccccc3)c3ccccc3)CC2)C(=O)N1c1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C31H34N4O5S/c36-29-23-28(31(37)35(29)26-11-13-27(14-12-26)41(38,39)34-19-21-40-22-20-34)32-15-17-33(18-16-32)30(24-7-3-1-4-8-24)25-9-5-2-6-10-25/h1-14,28,30H,15-23H2/t28-/m1/s1 |
| InChIKey | LJSOYWRKLBQFFM-MUUNZHRXSA-N |
| XLogP | 2.75 |
| TPSA | 90.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.70 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|