C22H21Cl2N3O4 — CID 51514552
1-[(3R)-1-(3,4-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(2-hydroxyphenyl)piperidine-4-carboxamide (PubChem CID 51514552) has the molecular formula C22H21Cl2N3O4 and a molecular weight of 462.33 g/mol. Its IUPAC name is 1-[(3R)-1-(3,4-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(2-hydroxyphenyl)piperidine-4-carboxamide.
| Compound Name | 1-[(3R)-1-(3,4-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(2-hydroxyphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 51514552 |
| Molecular Formula | C22H21Cl2N3O4 |
| Molecular Weight | 462.33 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | 1-[(3R)-1-(3,4-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(2-hydroxyphenyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccccc1O)C1CCN([C@@H]2CC(=O)N(c3ccc(Cl)c(Cl)c3)C2=O)CC1 |
| InChI | InChI=1S/C22H21Cl2N3O4/c23-15-6-5-14(11-16(15)24)27-20(29)12-18(22(27)31)26-9-7-13(8-10-26)21(30)25-17-3-1-2-4-19(17)28/h1-6,11,13,18,28H,7-10,12H2,(H,25,30)/t18-/m1/s1 |
| InChIKey | XVQZBAFEAPFKOJ-GOSISDBHSA-N |
| XLogP | 3.68 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.33 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|