C22H22BrN3O3 — CID 51546507
1-[(3R)-1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-N-phenylpiperidine-4-carboxamide (PubChem CID 51546507) has the molecular formula C22H22BrN3O3 and a molecular weight of 456.34 g/mol. Its IUPAC name is 1-[(3R)-1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-N-phenylpiperidine-4-carboxamide.
| Compound Name | 1-[(3R)-1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-N-phenylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 51546507 |
| Molecular Formula | C22H22BrN3O3 |
| Molecular Weight | 456.34 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | 1-[(3R)-1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-N-phenylpiperidine-4-carboxamide |
| SMILES | O=C(Nc1ccccc1)C1CCN([C@@H]2CC(=O)N(c3ccc(Br)cc3)C2=O)CC1 |
| InChI | InChI=1S/C22H22BrN3O3/c23-16-6-8-18(9-7-16)26-20(27)14-19(22(26)29)25-12-10-15(11-13-25)21(28)24-17-4-2-1-3-5-17/h1-9,15,19H,10-14H2,(H,24,28)/t19-/m1/s1 |
| InChIKey | SXMVWFPFIGNNPG-LJQANCHMSA-N |
| XLogP | 3.43 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.34 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|