C24H28ClN3O3 — CID 42891823
1-[1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]-N-phenylpiperidine-4-carboxamide;hydrochloride (PubChem CID 42891823) has the molecular formula C24H28ClN3O3 and a molecular weight of 441.96 g/mol. Its IUPAC name is 1-[1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]-N-phenylpiperidine-4-carboxamide;hydrochloride.
| Compound Name | 1-[1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]-N-phenylpiperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 42891823 |
| Molecular Formula | C24H28ClN3O3 |
| Molecular Weight | 441.96 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 1-[1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]-N-phenylpiperidine-4-carboxamide;hydrochloride |
| SMILES | Cc1cccc(C)c1N1C(=O)CC(N2CCC(C(=O)Nc3ccccc3)CC2)C1=O.Cl |
| InChI | InChI=1S/C24H27N3O3.ClH/c1-16-7-6-8-17(2)22(16)27-21(28)15-20(24(27)30)26-13-11-18(12-14-26)23(29)25-19-9-4-3-5-10-19;/h3-10,18,20H,11-15H2,1-2H3,(H,25,29);1H |
| InChIKey | ZRCCFVQRADUKBL-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.96 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|