C22H23FN4O3 — CID 5145620
2-[4-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]piperazin-1-yl]-N-phenylacetamide (PubChem CID 5145620) has the molecular formula C22H23FN4O3 and a molecular weight of 410.45 g/mol. Its IUPAC name is 2-[4-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]piperazin-1-yl]-N-phenylacetamide.
| Compound Name | 2-[4-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]piperazin-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 5145620 |
| Molecular Formula | C22H23FN4O3 |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 2-[4-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]piperazin-1-yl]-N-phenylacetamide |
| SMILES | O=C(CN1CCN(C2CC(=O)N(c3ccc(F)cc3)C2=O)CC1)Nc1ccccc1 |
| InChI | InChI=1S/C22H23FN4O3/c23-16-6-8-18(9-7-16)27-21(29)14-19(22(27)30)26-12-10-25(11-13-26)15-20(28)24-17-4-2-1-3-5-17/h1-9,19H,10-15H2,(H,24,28) |
| InChIKey | QYGBLUZNTWBPRT-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|