C22H29ClN3O3+ — CID 7326000
(3S)-1-(4-chlorophenyl)-3-[4-(4-methylpiperidine-1-carbonyl)piperidin-1-ium-1-yl]pyrrolidine-2,5-dione (PubChem CID 7326000) has the molecular formula C22H29ClN3O3+ and a molecular weight of 418.95 g/mol. Its IUPAC name is (3S)-1-(4-chlorophenyl)-3-[4-(4-methylpiperidine-1-carbonyl)piperidin-1-ium-1-yl]pyrrolidine-2,5-dione.
| Compound Name | (3S)-1-(4-chlorophenyl)-3-[4-(4-methylpiperidine-1-carbonyl)piperidin-1-ium-1-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 7326000 |
| Molecular Formula | C22H29ClN3O3+ |
| Molecular Weight | 418.95 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | (3S)-1-(4-chlorophenyl)-3-[4-(4-methylpiperidine-1-carbonyl)piperidin-1-ium-1-yl]pyrrolidine-2,5-dione |
| SMILES | CC1CCN(C(=O)C2CC[NH+]([C@H]3CC(=O)N(c4ccc(Cl)cc4)C3=O)CC2)CC1 |
| InChI | InChI=1S/C22H28ClN3O3/c1-15-6-10-25(11-7-15)21(28)16-8-12-24(13-9-16)19-14-20(27)26(22(19)29)18-4-2-17(23)3-5-18/h2-5,15-16,19H,6-14H2,1H3/p+1/t19-/m0/s1 |
| InChIKey | GLNCJORFGALERL-IBGZPJMESA-O |
| XLogP | 1.53 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.95 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|