C23H32N3O5+ — CID 7323394
(3S)-1-(3,5-dimethoxyphenyl)-3-[4-(piperidine-1-carbonyl)piperidin-1-ium-1-yl]pyrrolidine-2,5-dione (PubChem CID 7323394) has the molecular formula C23H32N3O5+ and a molecular weight of 430.53 g/mol. Its IUPAC name is (3S)-1-(3,5-dimethoxyphenyl)-3-[4-(piperidine-1-carbonyl)piperidin-1-ium-1-yl]pyrrolidine-2,5-dione.
| Compound Name | (3S)-1-(3,5-dimethoxyphenyl)-3-[4-(piperidine-1-carbonyl)piperidin-1-ium-1-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 7323394 |
| Molecular Formula | C23H32N3O5+ |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | (3S)-1-(3,5-dimethoxyphenyl)-3-[4-(piperidine-1-carbonyl)piperidin-1-ium-1-yl]pyrrolidine-2,5-dione |
| SMILES | COc1cc(OC)cc(N2C(=O)C[C@H]([NH+]3CCC(C(=O)N4CCCCC4)CC3)C2=O)c1 |
| InChI | InChI=1S/C23H31N3O5/c1-30-18-12-17(13-19(14-18)31-2)26-21(27)15-20(23(26)29)24-10-6-16(7-11-24)22(28)25-8-4-3-5-9-25/h12-14,16,20H,3-11,15H2,1-2H3/p+1/t20-/m0/s1 |
| InChIKey | MGCBHOAIWLOOIV-FQEVSTJZSA-O |
| XLogP | 0.64 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|