C24H33N3O2+2 — CID 7288951
(3R)-3-[4-(1-adamantyl)piperazine-1,4-diium-1-yl]-1-phenylpyrrolidine-2,5-dione (PubChem CID 7288951) has the molecular formula C24H33N3O2+2 and a molecular weight of 395.55 g/mol. Its IUPAC name is (3R)-3-[4-(1-adamantyl)piperazine-1,4-diium-1-yl]-1-phenylpyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[4-(1-adamantyl)piperazine-1,4-diium-1-yl]-1-phenylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 7288951 |
| Molecular Formula | C24H33N3O2+2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | (3R)-3-[4-(1-adamantyl)piperazine-1,4-diium-1-yl]-1-phenylpyrrolidine-2,5-dione |
| SMILES | O=C1C[C@@H]([NH+]2CC[NH+](C34CC5CC(CC(C5)C3)C4)CC2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C24H31N3O2/c28-22-13-21(23(29)27(22)20-4-2-1-3-5-20)25-6-8-26(9-7-25)24-14-17-10-18(15-24)12-19(11-17)16-24/h1-5,17-19,21H,6-16H2/p+2/t17?,18?,19?,21-,24?/m1/s1 |
| InChIKey | QDAYJKBPVWIXSM-ZNKOEICNSA-P |
| XLogP | 0.07 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|