C19H31N3O2+2 — CID 7288905
(3R)-3-[4-(1-adamantyl)piperazine-1,4-diium-1-yl]-1-methylpyrrolidine-2,5-dione (PubChem CID 7288905) has the molecular formula C19H31N3O2+2 and a molecular weight of 333.48 g/mol. Its IUPAC name is (3R)-3-[4-(1-adamantyl)piperazine-1,4-diium-1-yl]-1-methylpyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[4-(1-adamantyl)piperazine-1,4-diium-1-yl]-1-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 7288905 |
| Molecular Formula | C19H31N3O2+2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.24 |
| IUPAC Name | (3R)-3-[4-(1-adamantyl)piperazine-1,4-diium-1-yl]-1-methylpyrrolidine-2,5-dione |
| SMILES | CN1C(=O)C[C@@H]([NH+]2CC[NH+](C34CC5CC(CC(C5)C3)C4)CC2)C1=O |
| InChI | InChI=1S/C19H29N3O2/c1-20-17(23)9-16(18(20)24)21-2-4-22(5-3-21)19-10-13-6-14(11-19)8-15(7-13)12-19/h13-16H,2-12H2,1H3/p+2/t13?,14?,15?,16-,19?/m1/s1 |
| InChIKey | WVQOEYAXAXTOHS-LZUXJJCOSA-P |
| XLogP | -1.50 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|