C11H22N4O2+2 — CID 7453791
(3R)-1-(dimethylamino)-3-(4-methylpiperazine-1,4-diium-1-yl)pyrrolidine-2,5-dione (PubChem CID 7453791) has the molecular formula C11H22N4O2+2 and a molecular weight of 242.32 g/mol. Its IUPAC name is (3R)-1-(dimethylamino)-3-(4-methylpiperazine-1,4-diium-1-yl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-1-(dimethylamino)-3-(4-methylpiperazine-1,4-diium-1-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 7453791 |
| Molecular Formula | C11H22N4O2+2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | (3R)-1-(dimethylamino)-3-(4-methylpiperazine-1,4-diium-1-yl)pyrrolidine-2,5-dione |
| SMILES | CN(C)N1C(=O)C[C@@H]([NH+]2CC[NH+](C)CC2)C1=O |
| InChI | InChI=1S/C11H20N4O2/c1-12(2)15-10(16)8-9(11(15)17)14-6-4-13(3)5-7-14/h9H,4-8H2,1-3H3/p+2/t9-/m1/s1 |
| InChIKey | NNNZIRJXPXJRPZ-SECBINFHSA-P |
| XLogP | -4.00 |
| TPSA | 49.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | -4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|