C27H28BrN3O2+2 — CID 6968746
(3R)-3-(4-benzhydrylpiperazine-1,4-diium-1-yl)-1-(3-bromophenyl)pyrrolidine-2,5-dione (PubChem CID 6968746) has the molecular formula C27H28BrN3O2+2 and a molecular weight of 506.44 g/mol. Its IUPAC name is (3R)-3-(4-benzhydrylpiperazine-1,4-diium-1-yl)-1-(3-bromophenyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-(4-benzhydrylpiperazine-1,4-diium-1-yl)-1-(3-bromophenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 6968746 |
| Molecular Formula | C27H28BrN3O2+2 |
| Molecular Weight | 506.44 g/mol |
| Exact Mass | 505.14 |
| IUPAC Name | (3R)-3-(4-benzhydrylpiperazine-1,4-diium-1-yl)-1-(3-bromophenyl)pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@@H]([NH+]2CC[NH+](C(c3ccccc3)c3ccccc3)CC2)C(=O)N1c1cccc(Br)c1 |
| InChI | InChI=1S/C27H26BrN3O2/c28-22-12-7-13-23(18-22)31-25(32)19-24(27(31)33)29-14-16-30(17-15-29)26(20-8-3-1-4-9-20)21-10-5-2-6-11-21/h1-13,18,24,26H,14-17,19H2/p+2/t24-/m1/s1 |
| InChIKey | GTVCTKSEZAHBGP-XMMPIXPASA-P |
| XLogP | 1.65 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.44 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|