C21H25N3O4S — CID 30671192
(3R)-1-(2,4-dimethoxyphenyl)-3-[4-(thiophen-2-ylmethyl)piperazin-1-yl]pyrrolidine-2,5-dione (PubChem CID 30671192) has the molecular formula C21H25N3O4S and a molecular weight of 415.52 g/mol. Its IUPAC name is (3R)-1-(2,4-dimethoxyphenyl)-3-[4-(thiophen-2-ylmethyl)piperazin-1-yl]pyrrolidine-2,5-dione.
| Compound Name | (3R)-1-(2,4-dimethoxyphenyl)-3-[4-(thiophen-2-ylmethyl)piperazin-1-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 30671192 |
| Molecular Formula | C21H25N3O4S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | (3R)-1-(2,4-dimethoxyphenyl)-3-[4-(thiophen-2-ylmethyl)piperazin-1-yl]pyrrolidine-2,5-dione |
| SMILES | COc1ccc(N2C(=O)C[C@@H](N3CCN(Cc4cccs4)CC3)C2=O)c(OC)c1 |
| InChI | InChI=1S/C21H25N3O4S/c1-27-15-5-6-17(19(12-15)28-2)24-20(25)13-18(21(24)26)23-9-7-22(8-10-23)14-16-4-3-11-29-16/h3-6,11-12,18H,7-10,13-14H2,1-2H3/t18-/m1/s1 |
| InChIKey | BDPPEDUXSAXQRV-GOSISDBHSA-N |
| XLogP | 2.21 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|