C19H20BrN3O2S — CID 98345854
(3S)-1-(2-bromophenyl)-3-[4-(thiophen-2-ylmethyl)piperazin-1-yl]pyrrolidine-2,5-dione (PubChem CID 98345854) has the molecular formula C19H20BrN3O2S and a molecular weight of 434.36 g/mol. Its IUPAC name is (3S)-1-(2-bromophenyl)-3-[4-(thiophen-2-ylmethyl)piperazin-1-yl]pyrrolidine-2,5-dione.
| Compound Name | (3S)-1-(2-bromophenyl)-3-[4-(thiophen-2-ylmethyl)piperazin-1-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 98345854 |
| Molecular Formula | C19H20BrN3O2S |
| Molecular Weight | 434.36 g/mol |
| Exact Mass | 433.05 |
| IUPAC Name | (3S)-1-(2-bromophenyl)-3-[4-(thiophen-2-ylmethyl)piperazin-1-yl]pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@H](N2CCN(Cc3cccs3)CC2)C(=O)N1c1ccccc1Br |
| InChI | InChI=1S/C19H20BrN3O2S/c20-15-5-1-2-6-16(15)23-18(24)12-17(19(23)25)22-9-7-21(8-10-22)13-14-4-3-11-26-14/h1-6,11,17H,7-10,12-13H2/t17-/m0/s1 |
| InChIKey | AOXGWTMOOFRERN-KRWDZBQOSA-N |
| XLogP | 2.96 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|