C21H24ClN3O4S — CID 42919033
3-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-1-(3,4-dimethoxyphenyl)pyrrolidine-2,5-dione (PubChem CID 42919033) has the molecular formula C21H24ClN3O4S and a molecular weight of 449.96 g/mol. Its IUPAC name is 3-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-1-(3,4-dimethoxyphenyl)pyrrolidine-2,5-dione.
| Compound Name | 3-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-1-(3,4-dimethoxyphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 42919033 |
| Molecular Formula | C21H24ClN3O4S |
| Molecular Weight | 449.96 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | 3-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-1-(3,4-dimethoxyphenyl)pyrrolidine-2,5-dione |
| SMILES | COc1ccc(N2C(=O)CC(N3CCN(Cc4ccc(Cl)s4)CC3)C2=O)cc1OC |
| InChI | InChI=1S/C21H24ClN3O4S/c1-28-17-5-3-14(11-18(17)29-2)25-20(26)12-16(21(25)27)24-9-7-23(8-10-24)13-15-4-6-19(22)30-15/h3-6,11,16H,7-10,12-13H2,1-2H3 |
| InChIKey | NNDKNWDCSBMBLK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.96 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|