C24H21F2N3O4S — CID 2620703
(3S)-1-(2,4-difluorophenyl)-3-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)pyrrolidine-2,5-dione (PubChem CID 2620703) has the molecular formula C24H21F2N3O4S and a molecular weight of 485.51 g/mol. Its IUPAC name is (3S)-1-(2,4-difluorophenyl)-3-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-1-(2,4-difluorophenyl)-3-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 2620703 |
| Molecular Formula | C24H21F2N3O4S |
| Molecular Weight | 485.51 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | (3S)-1-(2,4-difluorophenyl)-3-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@H](N2CCN(S(=O)(=O)c3ccc4ccccc4c3)CC2)C(=O)N1c1ccc(F)cc1F |
| InChI | InChI=1S/C24H21F2N3O4S/c25-18-6-8-21(20(26)14-18)29-23(30)15-22(24(29)31)27-9-11-28(12-10-27)34(32,33)19-7-5-16-3-1-2-4-17(16)13-19/h1-8,13-14,22H,9-12,15H2/t22-/m0/s1 |
| InChIKey | XDMGXMKOFFCBIU-QFIPXVFZSA-N |
| XLogP | 2.76 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.51 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|