C21H23F3N4O5S — CID 17378154
1-[[1-(4-methoxyphenyl)sulfonylpiperidine-4-carbonyl]amino]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 17378154) has the molecular formula C21H23F3N4O5S and a molecular weight of 500.50 g/mol. Its IUPAC name is 1-[[1-(4-methoxyphenyl)sulfonylpiperidine-4-carbonyl]amino]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[[1-(4-methoxyphenyl)sulfonylpiperidine-4-carbonyl]amino]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 17378154 |
| Molecular Formula | C21H23F3N4O5S |
| Molecular Weight | 500.50 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | 1-[[1-(4-methoxyphenyl)sulfonylpiperidine-4-carbonyl]amino]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | COc1ccc(S(=O)(=O)N2CCC(C(=O)NNC(=O)Nc3cccc(C(F)(F)F)c3)CC2)cc1 |
| InChI | InChI=1S/C21H23F3N4O5S/c1-33-17-5-7-18(8-6-17)34(31,32)28-11-9-14(10-12-28)19(29)26-27-20(30)25-16-4-2-3-15(13-16)21(22,23)24/h2-8,13-14H,9-12H2,1H3,(H,26,29)(H2,25,27,30) |
| InChIKey | KSAOJPZRELXLLF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.50 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|