C18H22ClNO2S2 — CID 121146791
3-(4-chlorophenyl)-1-(5-ethylthiophen-2-yl)sulfonylazepane (PubChem CID 121146791) has the molecular formula C18H22ClNO2S2 and a molecular weight of 383.97 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-(5-ethylthiophen-2-yl)sulfonylazepane.
| Compound Name | 3-(4-chlorophenyl)-1-(5-ethylthiophen-2-yl)sulfonylazepane |
|---|---|
| PubChem CID | 121146791 |
| Molecular Formula | C18H22ClNO2S2 |
| Molecular Weight | 383.97 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 3-(4-chlorophenyl)-1-(5-ethylthiophen-2-yl)sulfonylazepane |
| SMILES | CCc1ccc(S(=O)(=O)N2CCCCC(c3ccc(Cl)cc3)C2)s1 |
| InChI | InChI=1S/C18H22ClNO2S2/c1-2-17-10-11-18(23-17)24(21,22)20-12-4-3-5-15(13-20)14-6-8-16(19)9-7-14/h6-11,15H,2-5,12-13H2,1H3 |
| InChIKey | GCCRNKIGLVJQFN-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.97 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |