C17H20BrNO3S2 — CID 121147281
1-(5-bromothiophen-2-yl)sulfonyl-3-(4-methoxyphenyl)azepane (PubChem CID 121147281) has the molecular formula C17H20BrNO3S2 and a molecular weight of 430.39 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)sulfonyl-3-(4-methoxyphenyl)azepane.
| Compound Name | 1-(5-bromothiophen-2-yl)sulfonyl-3-(4-methoxyphenyl)azepane |
|---|---|
| PubChem CID | 121147281 |
| Molecular Formula | C17H20BrNO3S2 |
| Molecular Weight | 430.39 g/mol |
| Exact Mass | 429.01 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)sulfonyl-3-(4-methoxyphenyl)azepane |
| SMILES | COc1ccc(C2CCCCN(S(=O)(=O)c3ccc(Br)s3)C2)cc1 |
| InChI | InChI=1S/C17H20BrNO3S2/c1-22-15-7-5-13(6-8-15)14-4-2-3-11-19(12-14)24(20,21)17-10-9-16(18)23-17/h5-10,14H,2-4,11-12H2,1H3 |
| InChIKey | BCRANTZSDSYTIU-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.39 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |