C19H21ClFNO2S — CID 121146863
3-(4-chlorophenyl)-1-(4-fluoro-2-methylphenyl)sulfonylazepane (PubChem CID 121146863) has the molecular formula C19H21ClFNO2S and a molecular weight of 381.90 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-(4-fluoro-2-methylphenyl)sulfonylazepane.
| Compound Name | 3-(4-chlorophenyl)-1-(4-fluoro-2-methylphenyl)sulfonylazepane |
|---|---|
| PubChem CID | 121146863 |
| Molecular Formula | C19H21ClFNO2S |
| Molecular Weight | 381.90 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 3-(4-chlorophenyl)-1-(4-fluoro-2-methylphenyl)sulfonylazepane |
| SMILES | Cc1cc(F)ccc1S(=O)(=O)N1CCCCC(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C19H21ClFNO2S/c1-14-12-18(21)9-10-19(14)25(23,24)22-11-3-2-4-16(13-22)15-5-7-17(20)8-6-15/h5-10,12,16H,2-4,11,13H2,1H3 |
| InChIKey | UNOGSIPUOJCVMI-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.90 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |