C23H30N2O4S — CID 22771600
4-(1-adamantyl)-1-(2,5-dimethoxyphenyl)sulfonyl-3,5-dimethylpyrazole (PubChem CID 22771600) has the molecular formula C23H30N2O4S and a molecular weight of 430.57 g/mol. Its IUPAC name is 4-(1-adamantyl)-1-(2,5-dimethoxyphenyl)sulfonyl-3,5-dimethylpyrazole.
| Compound Name | 4-(1-adamantyl)-1-(2,5-dimethoxyphenyl)sulfonyl-3,5-dimethylpyrazole |
|---|---|
| PubChem CID | 22771600 |
| Molecular Formula | C23H30N2O4S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 4-(1-adamantyl)-1-(2,5-dimethoxyphenyl)sulfonyl-3,5-dimethylpyrazole |
| SMILES | COc1ccc(OC)c(S(=O)(=O)n2nc(C)c(C34CC5CC(CC(C5)C3)C4)c2C)c1 |
| InChI | InChI=1S/C23H30N2O4S/c1-14-22(23-11-16-7-17(12-23)9-18(8-16)13-23)15(2)25(24-14)30(26,27)21-10-19(28-3)5-6-20(21)29-4/h5-6,10,16-18H,7-9,11-13H2,1-4H3 |
| InChIKey | WJPFJMUUGLNOGA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |