C25H30N2O4S — CID 3257461
N-(1-adamantyl)-3-[(2-methoxyphenyl)sulfamoyl]-4-methylbenzamide (PubChem CID 3257461) has the molecular formula C25H30N2O4S and a molecular weight of 454.59 g/mol. Its IUPAC name is N-(1-adamantyl)-3-[(2-methoxyphenyl)sulfamoyl]-4-methylbenzamide.
| Compound Name | N-(1-adamantyl)-3-[(2-methoxyphenyl)sulfamoyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 3257461 |
| Molecular Formula | C25H30N2O4S |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | N-(1-adamantyl)-3-[(2-methoxyphenyl)sulfamoyl]-4-methylbenzamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1cc(C(=O)NC23CC4CC(CC(C4)C2)C3)ccc1C |
| InChI | InChI=1S/C25H30N2O4S/c1-16-7-8-20(12-23(16)32(29,30)27-21-5-3-4-6-22(21)31-2)24(28)26-25-13-17-9-18(14-25)11-19(10-17)15-25/h3-8,12,17-19,27H,9-11,13-15H2,1-2H3,(H,26,28) |
| InChIKey | YJQDOAZQFVFBDT-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |