C25H28N2O5S — CID 55945307
3-[(2-methoxyphenyl)sulfamoyl]-4-methyl-N-(2-methyl-4-propan-2-yloxyphenyl)benzamide (PubChem CID 55945307) has the molecular formula C25H28N2O5S and a molecular weight of 468.58 g/mol. Its IUPAC name is 3-[(2-methoxyphenyl)sulfamoyl]-4-methyl-N-(2-methyl-4-propan-2-yloxyphenyl)benzamide.
| Compound Name | 3-[(2-methoxyphenyl)sulfamoyl]-4-methyl-N-(2-methyl-4-propan-2-yloxyphenyl)benzamide |
|---|---|
| PubChem CID | 55945307 |
| Molecular Formula | C25H28N2O5S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 3-[(2-methoxyphenyl)sulfamoyl]-4-methyl-N-(2-methyl-4-propan-2-yloxyphenyl)benzamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1cc(C(=O)Nc2ccc(OC(C)C)cc2C)ccc1C |
| InChI | InChI=1S/C25H28N2O5S/c1-16(2)32-20-12-13-21(18(4)14-20)26-25(28)19-11-10-17(3)24(15-19)33(29,30)27-22-8-6-7-9-23(22)31-5/h6-16,27H,1-5H3,(H,26,28) |
| InChIKey | KFOMNJKEMHXZOB-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |