C15H26N4O — CID 80846576
2-N-(2-cyclohexyloxyethyl)-6-N-propylpyrazine-2,6-diamine (PubChem CID 80846576) has the molecular formula C15H26N4O and a molecular weight of 278.40 g/mol. Its IUPAC name is 2-N-(2-cyclohexyloxyethyl)-6-N-propylpyrazine-2,6-diamine.
| Compound Name | 2-N-(2-cyclohexyloxyethyl)-6-N-propylpyrazine-2,6-diamine |
|---|---|
| PubChem CID | 80846576 |
| Molecular Formula | C15H26N4O |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | 2-N-(2-cyclohexyloxyethyl)-6-N-propylpyrazine-2,6-diamine |
| SMILES | CCCNc1cncc(NCCOC2CCCCC2)n1 |
| InChI | InChI=1S/C15H26N4O/c1-2-8-17-14-11-16-12-15(19-14)18-9-10-20-13-6-4-3-5-7-13/h11-13H,2-10H2,1H3,(H2,17,18,19) |
| InChIKey | TVKIXVVHTHUCBS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|