C12H21N5 — CID 83027760
2-N-piperidin-1-yl-6-N-propylpyrazine-2,6-diamine (PubChem CID 83027760) has the molecular formula C12H21N5 and a molecular weight of 235.33 g/mol. Its IUPAC name is 2-N-piperidin-1-yl-6-N-propylpyrazine-2,6-diamine.
| Compound Name | 2-N-piperidin-1-yl-6-N-propylpyrazine-2,6-diamine |
|---|---|
| PubChem CID | 83027760 |
| Molecular Formula | C12H21N5 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.18 |
| IUPAC Name | 2-N-piperidin-1-yl-6-N-propylpyrazine-2,6-diamine |
| SMILES | CCCNc1cncc(NN2CCCCC2)n1 |
| InChI | InChI=1S/C12H21N5/c1-2-6-14-11-9-13-10-12(15-11)16-17-7-4-3-5-8-17/h9-10H,2-8H2,1H3,(H2,14,15,16) |
| InChIKey | GLLMZVBYDAHJFV-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |