C12H12Br2N4O — CID 103417153
2-N-(2,4-dibromo-5-methoxyphenyl)-6-N-methylpyrazine-2,6-diamine (PubChem CID 103417153) has the molecular formula C12H12Br2N4O and a molecular weight of 388.06 g/mol. Its IUPAC name is 2-N-(2,4-dibromo-5-methoxyphenyl)-6-N-methylpyrazine-2,6-diamine.
| Compound Name | 2-N-(2,4-dibromo-5-methoxyphenyl)-6-N-methylpyrazine-2,6-diamine |
|---|---|
| PubChem CID | 103417153 |
| Molecular Formula | C12H12Br2N4O |
| Molecular Weight | 388.06 g/mol |
| Exact Mass | 385.94 |
| IUPAC Name | 2-N-(2,4-dibromo-5-methoxyphenyl)-6-N-methylpyrazine-2,6-diamine |
| SMILES | CNc1cncc(Nc2cc(OC)c(Br)cc2Br)n1 |
| InChI | InChI=1S/C12H12Br2N4O/c1-15-11-5-16-6-12(18-11)17-9-4-10(19-2)8(14)3-7(9)13/h3-6H,1-2H3,(H2,15,17,18) |
| InChIKey | IPWHKSCGWKGOAV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.06 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |