C11H9Cl3N4 — CID 80759464
6-N-methyl-2-N-(2,4,5-trichlorophenyl)pyrazine-2,6-diamine (PubChem CID 80759464) has the molecular formula C11H9Cl3N4 and a molecular weight of 303.58 g/mol. Its IUPAC name is 6-N-methyl-2-N-(2,4,5-trichlorophenyl)pyrazine-2,6-diamine.
| Compound Name | 6-N-methyl-2-N-(2,4,5-trichlorophenyl)pyrazine-2,6-diamine |
|---|---|
| PubChem CID | 80759464 |
| Molecular Formula | C11H9Cl3N4 |
| Molecular Weight | 303.58 g/mol |
| Exact Mass | 301.99 |
| IUPAC Name | 6-N-methyl-2-N-(2,4,5-trichlorophenyl)pyrazine-2,6-diamine |
| SMILES | CNc1cncc(Nc2cc(Cl)c(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C11H9Cl3N4/c1-15-10-4-16-5-11(18-10)17-9-3-7(13)6(12)2-8(9)14/h2-5H,1H3,(H2,15,17,18) |
| InChIKey | GOQZDWFNRLPCBD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.58 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|