C9H7BrFN3OS — CID 103483695
5-bromo-4-fluoro-2-[(3-methyl-1,2,4-thiadiazol-5-yl)oxy]aniline (PubChem CID 103483695) has the molecular formula C9H7BrFN3OS and a molecular weight of 304.14 g/mol. Its IUPAC name is 5-bromo-4-fluoro-2-[(3-methyl-1,2,4-thiadiazol-5-yl)oxy]aniline.
| Compound Name | 5-bromo-4-fluoro-2-[(3-methyl-1,2,4-thiadiazol-5-yl)oxy]aniline |
|---|---|
| PubChem CID | 103483695 |
| Molecular Formula | C9H7BrFN3OS |
| Molecular Weight | 304.14 g/mol |
| Exact Mass | 302.95 |
| IUPAC Name | 5-bromo-4-fluoro-2-[(3-methyl-1,2,4-thiadiazol-5-yl)oxy]aniline |
| SMILES | Cc1nsc(Oc2cc(F)c(Br)cc2N)n1 |
| InChI | InChI=1S/C9H7BrFN3OS/c1-4-13-9(16-14-4)15-8-3-6(11)5(10)2-7(8)12/h2-3H,12H2,1H3 |
| InChIKey | YSKCJZYGQITSNF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.14 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|