C9H6BrFN2OS — CID 103483890
5-bromo-4-fluoro-2-(1,3-thiazol-2-yloxy)aniline (PubChem CID 103483890) has the molecular formula C9H6BrFN2OS and a molecular weight of 289.13 g/mol. Its IUPAC name is 5-bromo-4-fluoro-2-(1,3-thiazol-2-yloxy)aniline.
| Compound Name | 5-bromo-4-fluoro-2-(1,3-thiazol-2-yloxy)aniline |
|---|---|
| PubChem CID | 103483890 |
| Molecular Formula | C9H6BrFN2OS |
| Molecular Weight | 289.13 g/mol |
| Exact Mass | 287.94 |
| IUPAC Name | 5-bromo-4-fluoro-2-(1,3-thiazol-2-yloxy)aniline |
| SMILES | Nc1cc(Br)c(F)cc1Oc1nccs1 |
| InChI | InChI=1S/C9H6BrFN2OS/c10-5-3-7(12)8(4-6(5)11)14-9-13-1-2-15-9/h1-4H,12H2 |
| InChIKey | IAYRYAZSPYKMIC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.13 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|