C9H6BrClN2OS — CID 133424725
5-(2-bromo-4-chlorophenoxy)-3-methyl-1,2,4-thiadiazole (PubChem CID 133424725) has the molecular formula C9H6BrClN2OS and a molecular weight of 305.58 g/mol. Its IUPAC name is 5-(2-bromo-4-chlorophenoxy)-3-methyl-1,2,4-thiadiazole.
| Compound Name | 5-(2-bromo-4-chlorophenoxy)-3-methyl-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 133424725 |
| Molecular Formula | C9H6BrClN2OS |
| Molecular Weight | 305.58 g/mol |
| Exact Mass | 303.91 |
| IUPAC Name | 5-(2-bromo-4-chlorophenoxy)-3-methyl-1,2,4-thiadiazole |
| SMILES | Cc1nsc(Oc2ccc(Cl)cc2Br)n1 |
| InChI | InChI=1S/C9H6BrClN2OS/c1-5-12-9(15-13-5)14-8-3-2-6(11)4-7(8)10/h2-4H,1H3 |
| InChIKey | DYEIOHXDNFLTMA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.58 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |