C10H7ClN2O3S — CID 65273212
5-chloro-2-[(3-methyl-1,2,4-thiadiazol-5-yl)oxy]benzoic acid (PubChem CID 65273212) has the molecular formula C10H7ClN2O3S and a molecular weight of 270.70 g/mol. Its IUPAC name is 5-chloro-2-[(3-methyl-1,2,4-thiadiazol-5-yl)oxy]benzoic acid.
| Compound Name | 5-chloro-2-[(3-methyl-1,2,4-thiadiazol-5-yl)oxy]benzoic acid |
|---|---|
| PubChem CID | 65273212 |
| Molecular Formula | C10H7ClN2O3S |
| Molecular Weight | 270.70 g/mol |
| Exact Mass | 269.99 |
| IUPAC Name | 5-chloro-2-[(3-methyl-1,2,4-thiadiazol-5-yl)oxy]benzoic acid |
| SMILES | Cc1nsc(Oc2ccc(Cl)cc2C(=O)O)n1 |
| InChI | InChI=1S/C10H7ClN2O3S/c1-5-12-10(17-13-5)16-8-3-2-6(11)4-7(8)9(14)15/h2-4H,1H3,(H,14,15) |
| InChIKey | DXYZTYVVNBDKMG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.70 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |