C13H15N7O3S — CID 169345602
5-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-2-[(dimethylamino)methyl]benzenesulfonic acid (PubChem CID 169345602) has the molecular formula C13H15N7O3S and a molecular weight of 349.38 g/mol. Its IUPAC name is 5-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-2-[(dimethylamino)methyl]benzenesulfonic acid.
| Compound Name | 5-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-2-[(dimethylamino)methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 169345602 |
| Molecular Formula | C13H15N7O3S |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 5-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-2-[(dimethylamino)methyl]benzenesulfonic acid |
| SMILES | CN(C)Cc1ccc(NC=C(C#N)c2nn[nH]n2)cc1S(=O)(=O)O |
| InChI | InChI=1S/C13H15N7O3S/c1-20(2)8-9-3-4-11(5-12(9)24(21,22)23)15-7-10(6-14)13-16-18-19-17-13/h3-5,7,15H,8H2,1-2H3,(H,21,22,23)(H,16,17,18,19) |
| InChIKey | NAYLVEQAJBKOCO-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 147.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|