C14H8N6O6S2-2 — CID 169343692
6-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]naphthalene-1,3-disulfonate (PubChem CID 169343692) has the molecular formula C14H8N6O6S2-2 and a molecular weight of 420.39 g/mol. Its IUPAC name is 6-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]naphthalene-1,3-disulfonate.
| Compound Name | 6-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]naphthalene-1,3-disulfonate |
|---|---|
| PubChem CID | 169343692 |
| Molecular Formula | C14H8N6O6S2-2 |
| Molecular Weight | 420.39 g/mol |
| Exact Mass | 420.00 |
| IUPAC Name | 6-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]naphthalene-1,3-disulfonate |
| SMILES | N#CC(=CNc1ccc2c(S(=O)(=O)[O-])cc(S(=O)(=O)[O-])cc2c1)c1nn[nH]n1 |
| InChI | InChI=1S/C14H10N6O6S2/c15-6-9(14-17-19-20-18-14)7-16-10-1-2-12-8(3-10)4-11(27(21,22)23)5-13(12)28(24,25)26/h1-5,7,16H,(H,21,22,23)(H,24,25,26)(H,17,18,19,20)/p-2 |
| InChIKey | ADHYJZNNASYQFH-UHFFFAOYSA-L |
| XLogP | 0.14 |
| TPSA | 204.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.39 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|