C13H13N7O4S — CID 169345615
2-[[4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]sulfonylamino]propanoic acid (PubChem CID 169345615) has the molecular formula C13H13N7O4S and a molecular weight of 363.36 g/mol. Its IUPAC name is 2-[[4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]sulfonylamino]propanoic acid.
| Compound Name | 2-[[4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 169345615 |
| Molecular Formula | C13H13N7O4S |
| Molecular Weight | 363.36 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 2-[[4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]sulfonylamino]propanoic acid |
| SMILES | CC(NS(=O)(=O)c1ccc(NC=C(C#N)c2nn[nH]n2)cc1)C(=O)O |
| InChI | InChI=1S/C13H13N7O4S/c1-8(13(21)22)18-25(23,24)11-4-2-10(3-5-11)15-7-9(6-14)12-16-19-20-17-12/h2-5,7-8,15,18H,1H3,(H,21,22)(H,16,17,19,20) |
| InChIKey | ZOCOVXVPBMJETO-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 173.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.36 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|