C16H20N8O — CID 169344475
4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-N-[3-(dimethylamino)propyl]benzamide (PubChem CID 169344475) has the molecular formula C16H20N8O and a molecular weight of 340.39 g/mol. Its IUPAC name is 4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-N-[3-(dimethylamino)propyl]benzamide.
| Compound Name | 4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-N-[3-(dimethylamino)propyl]benzamide |
|---|---|
| PubChem CID | 169344475 |
| Molecular Formula | C16H20N8O |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-N-[3-(dimethylamino)propyl]benzamide |
| SMILES | CN(C)CCCNC(=O)c1ccc(NC=C(C#N)c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C16H20N8O/c1-24(2)9-3-8-18-16(25)12-4-6-14(7-5-12)19-11-13(10-17)15-20-22-23-21-15/h4-7,11,19H,3,8-9H2,1-2H3,(H,18,25)(H,20,21,22,23) |
| InChIKey | JDLKNHBEMMKBES-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 122.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|