C19H15N7O2S — CID 169343579
3-[[1-(4-methylphenyl)sulfonylindol-5-yl]amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169343579) has the molecular formula C19H15N7O2S and a molecular weight of 405.44 g/mol. Its IUPAC name is 3-[[1-(4-methylphenyl)sulfonylindol-5-yl]amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[[1-(4-methylphenyl)sulfonylindol-5-yl]amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169343579 |
| Molecular Formula | C19H15N7O2S |
| Molecular Weight | 405.44 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 3-[[1-(4-methylphenyl)sulfonylindol-5-yl]amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3cc(NC=C(C#N)c4nn[nH]n4)ccc32)cc1 |
| InChI | InChI=1S/C19H15N7O2S/c1-13-2-5-17(6-3-13)29(27,28)26-9-8-14-10-16(4-7-18(14)26)21-12-15(11-20)19-22-24-25-23-19/h2-10,12,21H,1H3,(H,22,23,24,25) |
| InChIKey | MDHVYMSIOQGAEA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 129.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.44 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|