C20H19N7O5S — CID 169345635
7-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-N,N-bis(2-hydroxyethyl)dibenzofuran-2-sulfonamide (PubChem CID 169345635) has the molecular formula C20H19N7O5S and a molecular weight of 469.48 g/mol. Its IUPAC name is 7-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-N,N-bis(2-hydroxyethyl)dibenzofuran-2-sulfonamide.
| Compound Name | 7-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-N,N-bis(2-hydroxyethyl)dibenzofuran-2-sulfonamide |
|---|---|
| PubChem CID | 169345635 |
| Molecular Formula | C20H19N7O5S |
| Molecular Weight | 469.48 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | 7-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-N,N-bis(2-hydroxyethyl)dibenzofuran-2-sulfonamide |
| SMILES | N#CC(=CNc1ccc2c(c1)oc1ccc(S(=O)(=O)N(CCO)CCO)cc12)c1nn[nH]n1 |
| InChI | InChI=1S/C20H19N7O5S/c21-11-13(20-23-25-26-24-20)12-22-14-1-3-16-17-10-15(2-4-18(17)32-19(16)9-14)33(30,31)27(5-7-28)6-8-29/h1-4,9-10,12,22,28-29H,5-8H2,(H,23,24,25,26) |
| InChIKey | XKXIJWFBECDNEM-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 181.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.48 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|