C17H12F3N7O3S — CID 169346309
4-[4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-2-(trifluoromethyl)phenoxy]benzenesulfonamide (PubChem CID 169346309) has the molecular formula C17H12F3N7O3S and a molecular weight of 451.39 g/mol. Its IUPAC name is 4-[4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-2-(trifluoromethyl)phenoxy]benzenesulfonamide.
| Compound Name | 4-[4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-2-(trifluoromethyl)phenoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 169346309 |
| Molecular Formula | C17H12F3N7O3S |
| Molecular Weight | 451.39 g/mol |
| Exact Mass | 451.07 |
| IUPAC Name | 4-[4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-2-(trifluoromethyl)phenoxy]benzenesulfonamide |
| SMILES | N#CC(=CNc1ccc(Oc2ccc(S(N)(=O)=O)cc2)c(C(F)(F)F)c1)c1nn[nH]n1 |
| InChI | InChI=1S/C17H12F3N7O3S/c18-17(19,20)14-7-11(23-9-10(8-21)16-24-26-27-25-16)1-6-15(14)30-12-2-4-13(5-3-12)31(22,28)29/h1-7,9,23H,(H2,22,28,29)(H,24,25,26,27) |
| InChIKey | RZFRIJBMFSSRPP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 159.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|