C13H10ClFN6O2 — CID 169343691
ethyl 2-chloro-5-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-4-fluorobenzoate (PubChem CID 169343691) has the molecular formula C13H10ClFN6O2 and a molecular weight of 336.71 g/mol. Its IUPAC name is ethyl 2-chloro-5-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-4-fluorobenzoate.
| Compound Name | ethyl 2-chloro-5-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-4-fluorobenzoate |
|---|---|
| PubChem CID | 169343691 |
| Molecular Formula | C13H10ClFN6O2 |
| Molecular Weight | 336.71 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | ethyl 2-chloro-5-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-4-fluorobenzoate |
| SMILES | CCOC(=O)c1cc(NC=C(C#N)c2nn[nH]n2)c(F)cc1Cl |
| InChI | InChI=1S/C13H10ClFN6O2/c1-2-23-13(22)8-3-11(10(15)4-9(8)14)17-6-7(5-16)12-18-20-21-19-12/h3-4,6,17H,2H2,1H3,(H,18,19,20,21) |
| InChIKey | GEMAGWSQRFIPMW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 116.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.71 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|