C20H17ClN6O3 — CID 169345565
ethyl 6-chloro-7-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-4-cyclopropyl-1-oxo-4H-naphthalene-2-carboxylate (PubChem CID 169345565) has the molecular formula C20H17ClN6O3 and a molecular weight of 424.85 g/mol. Its IUPAC name is ethyl 6-chloro-7-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-4-cyclopropyl-1-oxo-4H-naphthalene-2-carboxylate.
| Compound Name | ethyl 6-chloro-7-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-4-cyclopropyl-1-oxo-4H-naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 169345565 |
| Molecular Formula | C20H17ClN6O3 |
| Molecular Weight | 424.85 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | ethyl 6-chloro-7-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-4-cyclopropyl-1-oxo-4H-naphthalene-2-carboxylate |
| SMILES | CCOC(=O)C1=CC(C2CC2)c2cc(Cl)c(NC=C(C#N)c3nn[nH]n3)cc2C1=O |
| InChI | InChI=1S/C20H17ClN6O3/c1-2-30-20(29)15-5-12(10-3-4-10)13-6-16(21)17(7-14(13)18(15)28)23-9-11(8-22)19-24-26-27-25-19/h5-7,9-10,12,23H,2-4H2,1H3,(H,24,25,26,27) |
| InChIKey | GSBVQJPIVKYZRU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 133.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.85 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|