C17H19N7O3 — CID 169345281
3-[2-methyl-4-(2-morpholin-4-yl-2-oxoethoxy)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169345281) has the molecular formula C17H19N7O3 and a molecular weight of 369.39 g/mol. Its IUPAC name is 3-[2-methyl-4-(2-morpholin-4-yl-2-oxoethoxy)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[2-methyl-4-(2-morpholin-4-yl-2-oxoethoxy)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169345281 |
| Molecular Formula | C17H19N7O3 |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 3-[2-methyl-4-(2-morpholin-4-yl-2-oxoethoxy)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | Cc1cc(OCC(=O)N2CCOCC2)ccc1NC=C(C#N)c1nn[nH]n1 |
| InChI | InChI=1S/C17H19N7O3/c1-12-8-14(27-11-16(25)24-4-6-26-7-5-24)2-3-15(12)19-10-13(9-18)17-20-22-23-21-17/h2-3,8,10,19H,4-7,11H2,1H3,(H,20,21,22,23) |
| InChIKey | FBCLFZOOZDKCAQ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 129.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|