C19H24N8O4 — CID 169344173
methyl 3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]benzoate (PubChem CID 169344173) has the molecular formula C19H24N8O4 and a molecular weight of 428.45 g/mol. Its IUPAC name is methyl 3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]benzoate.
| Compound Name | methyl 3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]benzoate |
|---|---|
| PubChem CID | 169344173 |
| Molecular Formula | C19H24N8O4 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | methyl 3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]benzoate |
| SMILES | COC(=O)c1ccc(NCCNC(=O)OC(C)(C)C)c(NC=C(C#N)c2nn[nH]n2)c1 |
| InChI | InChI=1S/C19H24N8O4/c1-19(2,3)31-18(29)22-8-7-21-14-6-5-12(17(28)30-4)9-15(14)23-11-13(10-20)16-24-26-27-25-16/h5-6,9,11,21,23H,7-8H2,1-4H3,(H,22,29)(H,24,25,26,27) |
| InChIKey | NXFUDSXYKXIZCI-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 166.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|